C11H17N5O3S2 — CID 102782000
[1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-methylpyrrolidin-2-yl]methanol (PubChem CID 102782000) has the molecular formula C11H17N5O3S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-methylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102782000 |
| Molecular Formula | C11H17N5O3S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | [1-(6-hydrazinylimidazo[2,1-b][1,3]thiazol-5-yl)sulfonyl-3-methylpyrrolidin-2-yl]methanol |
| SMILES | CC1CCN(S(=O)(=O)c2c(NN)nc3sccn23)C1CO |
| InChI | InChI=1S/C11H17N5O3S2/c1-7-2-3-16(8(7)6-17)21(18,19)10-9(14-12)13-11-15(10)4-5-20-11/h4-5,7-8,14,17H,2-3,6,12H2,1H3 |
| InChIKey | VAZYVZNETMAFPM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|