C13H20N4O — CID 102783807
3,10-dimethyl-5-propyl-1,3,4,7-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4-dien-8-one (PubChem CID 102783807) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 3,10-dimethyl-5-propyl-1,3,4,7-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4-dien-8-one.
| Compound Name | 3,10-dimethyl-5-propyl-1,3,4,7-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4-dien-8-one |
|---|---|
| PubChem CID | 102783807 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3,10-dimethyl-5-propyl-1,3,4,7-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4-dien-8-one |
| SMILES | CCCc1nn(C)c2c1NC(=O)C1C(C)CCN21 |
| InChI | InChI=1S/C13H20N4O/c1-4-5-9-10-13(16(3)15-9)17-7-6-8(2)11(17)12(18)14-10/h8,11H,4-7H2,1-3H3,(H,14,18) |
| InChIKey | KRAXWOWFCAVGEH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |