About [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol
[1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol (PubChem CID 102784107) has the molecular formula C8H12BrN3OS
and a molecular weight of 278.18 g/mol. Its IUPAC name is [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol |
| PubChem CID | 102784107 |
| Molecular Formula | C8H12BrN3OS |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol |
| SMILES | CC1CCN(c2nnc(Br)s2)C1CO |
| InChI | InChI=1S/C8H12BrN3OS/c1-5-2-3-12(6(5)4-13)8-11-10-7(9)14-8/h5-6,13H,2-4H2,1H3 |
| InChIKey | XGKSMCXJCUAMNQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol?
The IUPAC name of [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol (CID 102784107) is [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol?
The canonical SMILES for [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol is CC1CCN(c2nnc(Br)s2)C1CO.
What is the InChIKey of [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol?
The InChIKey is XGKSMCXJCUAMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BrN3OS/c1-5-2-3-12(6(5)4-13)8-11-10-7(9)14-8/h5-6,13H,2-4H2,1H3.
What are the key properties of [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol?
[1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol has a molecular weight of 278.18 g/mol, XLogP of 1.51, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-methylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 102784107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).