C10H13ClFN3O — CID 102784110
[1-(2-chloro-5-fluoropyrimidin-4-yl)-3-methylpyrrolidin-2-yl]methanol (PubChem CID 102784110) has the molecular formula C10H13ClFN3O and a molecular weight of 245.68 g/mol. Its IUPAC name is [1-(2-chloro-5-fluoropyrimidin-4-yl)-3-methylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(2-chloro-5-fluoropyrimidin-4-yl)-3-methylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 102784110 |
| Molecular Formula | C10H13ClFN3O |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | [1-(2-chloro-5-fluoropyrimidin-4-yl)-3-methylpyrrolidin-2-yl]methanol |
| SMILES | CC1CCN(c2nc(Cl)ncc2F)C1CO |
| InChI | InChI=1S/C10H13ClFN3O/c1-6-2-3-15(8(6)5-16)9-7(12)4-13-10(11)14-9/h4,6,8,16H,2-3,5H2,1H3 |
| InChIKey | NWQNARRARPPRGF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |