C26H29ClN4O2S — CID 10278465
13-chloro-10-(3-imidazol-1-ylpropyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 10278465) has the molecular formula C26H29ClN4O2S and a molecular weight of 497.06 g/mol. Its IUPAC name is 13-chloro-10-(3-imidazol-1-ylpropyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | 13-chloro-10-(3-imidazol-1-ylpropyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 10278465 |
| Molecular Formula | C26H29ClN4O2S |
| Molecular Weight | 497.06 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 13-chloro-10-(3-imidazol-1-ylpropyl)-2-(1-methylsulfonylpiperidin-4-yl)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CS(=O)(=O)N1CCC(C2c3ccc(Cl)cc3C(CCCn3ccnc3)=Cc3cccnc32)CC1 |
| InChI | InChI=1S/C26H29ClN4O2S/c1-34(32,33)31-13-8-19(9-14-31)25-23-7-6-22(27)17-24(23)20(5-3-12-30-15-11-28-18-30)16-21-4-2-10-29-26(21)25/h2,4,6-7,10-11,15-19,25H,3,5,8-9,12-14H2,1H3 |
| InChIKey | HZKITVLGTXYUGU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.06 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |