About [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone
[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone (PubChem CID 102784796) has the molecular formula C16H20N2O2S
and a molecular weight of 304.41 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone |
| PubChem CID | 102784796 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CSC(c3ccccc3)=N2)C1CO |
| InChI | InChI=1S/C16H20N2O2S/c1-11-7-8-18(14(11)9-19)16(20)13-10-21-15(17-13)12-5-3-2-4-6-12/h2-6,11,13-14,19H,7-10H2,1H3 |
| InChIKey | FGKFWZDIHVMWFR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone?
The IUPAC name of [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone (CID 102784796) is [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone.
What is the SMILES notation for [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone?
The canonical SMILES for [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone is CC1CCN(C(=O)C2CSC(c3ccccc3)=N2)C1CO.
What is the InChIKey of [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone?
The InChIKey is FGKFWZDIHVMWFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2S/c1-11-7-8-18(14(11)9-19)16(20)13-10-21-15(17-13)12-5-3-2-4-6-12/h2-6,11,13-14,19H,7-10H2,1H3.
What are the key properties of [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone?
[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone has a molecular weight of 304.41 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]-(2-phenyl-4,5-dihydro-1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 102784796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).