C21H39N9O5 — CID 10278499
(2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(carbamoylamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide (PubChem CID 10278499) has the molecular formula C21H39N9O5 and a molecular weight of 497.60 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(carbamoylamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(carbamoylamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10278499 |
| Molecular Formula | C21H39N9O5 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.31 |
| IUPAC Name | (2S)-1-[(2S)-2-[[(2S)-2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-5-(carbamoylamino)pentanoyl]-N-ethylpyrrolidine-2-carboxamide |
| SMILES | CCNC(=O)[C@@H]1CCCN1C(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CCCN=C(N)N)NC(C)=O |
| InChI | InChI=1S/C21H39N9O5/c1-3-25-18(33)16-9-6-12-30(16)19(34)15(8-5-11-27-21(24)35)29-17(32)14(28-13(2)31)7-4-10-26-20(22)23/h14-16H,3-12H2,1-2H3,(H,25,33)(H,28,31)(H,29,32)(H4,22,23,26)(H3,24,27,35)/t14-,15-,16-/m0/s1 |
| InChIKey | AVDGVFVJDYCQQT-JYJNAYRXSA-N |
| XLogP | -2.39 |
| TPSA | 227.13 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|