C28H32N6OS — CID 10278669
11-(cyclopropylmethyl)-4-[2-(4-isoquinolin-1-ylpiperazin-1-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 10278669) has the molecular formula C28H32N6OS and a molecular weight of 500.67 g/mol. Its IUPAC name is 11-(cyclopropylmethyl)-4-[2-(4-isoquinolin-1-ylpiperazin-1-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-(cyclopropylmethyl)-4-[2-(4-isoquinolin-1-ylpiperazin-1-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 10278669 |
| Molecular Formula | C28H32N6OS |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 11-(cyclopropylmethyl)-4-[2-(4-isoquinolin-1-ylpiperazin-1-yl)ethyl]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1CCN1CCN(c2nccc4ccccc24)CC1)CN(CC1CC1)CC3 |
| InChI | InChI=1S/C28H32N6OS/c35-28-25-23-8-10-32(17-20-5-6-20)18-24(23)36-27(25)30-19-34(28)16-13-31-11-14-33(15-12-31)26-22-4-2-1-3-21(22)7-9-29-26/h1-4,7,9,19-20H,5-6,8,10-18H2 |
| InChIKey | GGYCGMPULPERLC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |