C14H17ClFNO — CID 102786719
[2-(chloromethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-methylphenyl)methanone (PubChem CID 102786719) has the molecular formula C14H17ClFNO and a molecular weight of 269.75 g/mol. Its IUPAC name is [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-methylphenyl)methanone.
| Compound Name | [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 102786719 |
| Molecular Formula | C14H17ClFNO |
| Molecular Weight | 269.75 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | [2-(chloromethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-methylphenyl)methanone |
| SMILES | Cc1ccc(F)cc1C(=O)N1CCC(C)C1CCl |
| InChI | InChI=1S/C14H17ClFNO/c1-9-3-4-11(16)7-12(9)14(18)17-6-5-10(2)13(17)8-15/h3-4,7,10,13H,5-6,8H2,1-2H3 |
| InChIKey | ALJHTAQFJIVASF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.75 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|