C21H25N7O4S2 — CID 10278814
ethyl 4-methyl-2-[[4-[(4-sulfamoylphenyl)methylamino]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 10278814) has the molecular formula C21H25N7O4S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is ethyl 4-methyl-2-[[4-[(4-sulfamoylphenyl)methylamino]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[[4-[(4-sulfamoylphenyl)methylamino]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 10278814 |
| Molecular Formula | C21H25N7O4S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | ethyl 4-methyl-2-[[4-[(4-sulfamoylphenyl)methylamino]-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-2-yl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(Nc2nc3c(c(NCc4ccc(S(N)(=O)=O)cc4)n2)CNCC3)nc1C |
| InChI | InChI=1S/C21H25N7O4S2/c1-3-32-19(29)17-12(2)25-21(33-17)28-20-26-16-8-9-23-11-15(16)18(27-20)24-10-13-4-6-14(7-5-13)34(22,30)31/h4-7,23H,3,8-11H2,1-2H3,(H2,22,30,31)(H2,24,25,26,27,28) |
| InChIKey | ZAFOPCAQOOXCKM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 161.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |