C17H18BrNO2 — CID 102788284
[2-(bromomethyl)-3-methylpyrrolidin-1-yl]-(1-hydroxynaphthalen-2-yl)methanone (PubChem CID 102788284) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is [2-(bromomethyl)-3-methylpyrrolidin-1-yl]-(1-hydroxynaphthalen-2-yl)methanone.
| Compound Name | [2-(bromomethyl)-3-methylpyrrolidin-1-yl]-(1-hydroxynaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 102788284 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | [2-(bromomethyl)-3-methylpyrrolidin-1-yl]-(1-hydroxynaphthalen-2-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc3ccccc3c2O)C1CBr |
| InChI | InChI=1S/C17H18BrNO2/c1-11-8-9-19(15(11)10-18)17(21)14-7-6-12-4-2-3-5-13(12)16(14)20/h2-7,11,15,20H,8-10H2,1H3 |
| InChIKey | OYTFYMLTMRYVHV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|