C14H18BrClN2O2 — CID 102788356
N-(4-bromo-2-chlorophenyl)-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]acetamide (PubChem CID 102788356) has the molecular formula C14H18BrClN2O2 and a molecular weight of 361.67 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 102788356 |
| Molecular Formula | C14H18BrClN2O2 |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-[2-(hydroxymethyl)-3-methylpyrrolidin-1-yl]acetamide |
| SMILES | CC1CCN(CC(=O)Nc2ccc(Br)cc2Cl)C1CO |
| InChI | InChI=1S/C14H18BrClN2O2/c1-9-4-5-18(13(9)8-19)7-14(20)17-12-3-2-10(15)6-11(12)16/h2-3,6,9,13,19H,4-5,7-8H2,1H3,(H,17,20) |
| InChIKey | JOXZIBJIESHLDE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |