C10H10N4O3 — CID 102790240
5-[(4-aminophenoxy)methyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102790240) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 5-[(4-aminophenoxy)methyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-[(4-aminophenoxy)methyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102790240 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-[(4-aminophenoxy)methyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | NC(=O)c1noc(COc2ccc(N)cc2)n1 |
| InChI | InChI=1S/C10H10N4O3/c11-6-1-3-7(4-2-6)16-5-8-13-10(9(12)15)14-17-8/h1-4H,5,11H2,(H2,12,15) |
| InChIKey | FXDOLCMFCGSNNW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|