C15H20N4O — CID 102791576
8-ethyl-3-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102791576) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 8-ethyl-3-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-ethyl-3-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102791576 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 8-ethyl-3-[(4-methoxyphenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCC1NCCn2c(Cc3ccc(OC)cc3)nnc21 |
| InChI | InChI=1S/C15H20N4O/c1-3-13-15-18-17-14(19(15)9-8-16-13)10-11-4-6-12(20-2)7-5-11/h4-7,13,16H,3,8-10H2,1-2H3 |
| InChIKey | PHKVASUKASGVOF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |