C15H24N4 — CID 102792079
3-(3-bicyclo[3.1.0]hexanyl)-8-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102792079) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-(3-bicyclo[3.1.0]hexanyl)-8-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-(3-bicyclo[3.1.0]hexanyl)-8-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102792079 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 3-(3-bicyclo[3.1.0]hexanyl)-8-tert-butyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CC(C)(C)C1NCCn2c(C3CC4CC4C3)nnc21 |
| InChI | InChI=1S/C15H24N4/c1-15(2,3)12-14-18-17-13(19(14)5-4-16-12)11-7-9-6-10(9)8-11/h9-12,16H,4-8H2,1-3H3 |
| InChIKey | ZIESVCMOHDQJDE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |