C13H20N6 — CID 102792242
3-tert-butyl-8-(1-methylpyrazol-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102792242) has the molecular formula C13H20N6 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-tert-butyl-8-(1-methylpyrazol-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-tert-butyl-8-(1-methylpyrazol-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102792242 |
| Molecular Formula | C13H20N6 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | 3-tert-butyl-8-(1-methylpyrazol-4-yl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | Cn1cc(C2NCCn3c2nnc3C(C)(C)C)cn1 |
| InChI | InChI=1S/C13H20N6/c1-13(2,3)12-17-16-11-10(14-5-6-19(11)12)9-7-15-18(4)8-9/h7-8,10,14H,5-6H2,1-4H3 |
| InChIKey | UEVUEDNQKIKTHW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |