C15H22N4S — CID 102792424
8-propyl-3-(3-thiophen-2-ylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 102792424) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is 8-propyl-3-(3-thiophen-2-ylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-propyl-3-(3-thiophen-2-ylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 102792424 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 8-propyl-3-(3-thiophen-2-ylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCC1NCCn2c(CCCc3cccs3)nnc21 |
| InChI | InChI=1S/C15H22N4S/c1-2-5-13-15-18-17-14(19(15)10-9-16-13)8-3-6-12-7-4-11-20-12/h4,7,11,13,16H,2-3,5-6,8-10H2,1H3 |
| InChIKey | XNOZOABCXBYJCP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |