About 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol
3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol (PubChem CID 102792781) has the molecular formula C10H17N5O
and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol |
| PubChem CID | 102792781 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol |
| SMILES | OC1CC(c2nc(N3CCNCC3)n[nH]2)C1 |
| InChI | InChI=1S/C10H17N5O/c16-8-5-7(6-8)9-12-10(14-13-9)15-3-1-11-2-4-15/h7-8,11,16H,1-6H2,(H,12,13,14) |
| InChIKey | XUUSRMPHOWQUBZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol?
The IUPAC name of 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol (CID 102792781) is 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol.
What is the SMILES notation for 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol?
The canonical SMILES for 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol is OC1CC(c2nc(N3CCNCC3)n[nH]2)C1.
What is the InChIKey of 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol?
The InChIKey is XUUSRMPHOWQUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N5O/c16-8-5-7(6-8)9-12-10(14-13-9)15-3-1-11-2-4-15/h7-8,11,16H,1-6H2,(H,12,13,14).
What are the key properties of 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol?
3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol has a molecular weight of 223.28 g/mol, XLogP of -0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-piperazin-1-yl-1H-1,2,4-triazol-5-yl)cyclobutan-1-ol is sourced from PubChem (CID 102792781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).