C13H16FN5 — CID 102792860
1-[5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]piperazine (PubChem CID 102792860) has the molecular formula C13H16FN5 and a molecular weight of 261.30 g/mol. Its IUPAC name is 1-[5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]piperazine.
| Compound Name | 1-[5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]piperazine |
|---|---|
| PubChem CID | 102792860 |
| Molecular Formula | C13H16FN5 |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-[5-[(3-fluorophenyl)methyl]-1H-1,2,4-triazol-3-yl]piperazine |
| SMILES | Fc1cccc(Cc2nc(N3CCNCC3)n[nH]2)c1 |
| InChI | InChI=1S/C13H16FN5/c14-11-3-1-2-10(8-11)9-12-16-13(18-17-12)19-6-4-15-5-7-19/h1-3,8,15H,4-7,9H2,(H,16,17,18) |
| InChIKey | UDYSIOQONOGKKW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |