About methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate
methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate (PubChem CID 102794947) has the molecular formula C10H13F2NO5S2
and a molecular weight of 329.35 g/mol. Its IUPAC name is methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| PubChem CID | 102794947 |
| Molecular Formula | C10H13F2NO5S2 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C10H13F2NO5S2/c1-6-3-19-7(9(15)18-2)8(6)20(16,17)13-4-10(11,12)5-14/h3,13-14H,4-5H2,1-2H3 |
| InChIKey | CCRTWZPDKSBERQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate?
The IUPAC name of methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate (CID 102794947) is methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate.
What is the SMILES notation for methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate?
The canonical SMILES for methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate is COC(=O)c1scc(C)c1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate?
The InChIKey is CCRTWZPDKSBERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO5S2/c1-6-3-19-7(9(15)18-2)8(6)20(16,17)13-4-10(11,12)5-14/h3,13-14H,4-5H2,1-2H3.
What are the key properties of methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate?
methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate has a molecular weight of 329.35 g/mol, XLogP of 0.75, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,2-difluoro-3-hydroxypropyl)sulfamoyl]-4-methylthiophene-2-carboxylate is sourced from PubChem (CID 102794947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).