About N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide
N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 102794960) has the molecular formula C10H16N2O3S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 102794960 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)CC2CC(O)C2)s1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-7-11-5-10(16-7)17(14,15)12(2)6-8-3-9(13)4-8/h5,8-9,13H,3-4,6H2,1-2H3 |
| InChIKey | LCVYRRNPHRFEMK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide (CID 102794960) is N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide is Cc1ncc(S(=O)(=O)N(C)CC2CC(O)C2)s1.
What is the InChIKey of N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is LCVYRRNPHRFEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S2/c1-7-11-5-10(16-7)17(14,15)12(2)6-8-3-9(13)4-8/h5,8-9,13H,3-4,6H2,1-2H3.
What are the key properties of N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide?
N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 276.38 g/mol, XLogP of 0.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-hydroxycyclobutyl)methyl]-N,2-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 102794960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).