C8H11N5 — CID 102795605
5-amino-3-(cyclopropylmethylamino)-1H-pyrazole-4-carbonitrile (PubChem CID 102795605) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-amino-3-(cyclopropylmethylamino)-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(cyclopropylmethylamino)-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795605 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 5-amino-3-(cyclopropylmethylamino)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(NCC2CC2)n[nH]c1N |
| InChI | InChI=1S/C8H11N5/c9-3-6-7(10)12-13-8(6)11-4-5-1-2-5/h5H,1-2,4H2,(H4,10,11,12,13) |
| InChIKey | CYLOIBWLFQURLE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |