About 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile
5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile (PubChem CID 102795608) has the molecular formula C7H8F3N5
and a molecular weight of 219.17 g/mol. Its IUPAC name is 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile |
| PubChem CID | 102795608 |
| Molecular Formula | C7H8F3N5 |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(NCCC(F)(F)F)n[nH]c1N |
| InChI | InChI=1S/C7H8F3N5/c8-7(9,10)1-2-13-6-4(3-11)5(12)14-15-6/h1-2H2,(H4,12,13,14,15) |
| InChIKey | MGQAPUGDIVRMGG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile?
The IUPAC name of 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile (CID 102795608) is 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile.
What is the SMILES notation for 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile?
The canonical SMILES for 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile is N#Cc1c(NCCC(F)(F)F)n[nH]c1N.
What is the InChIKey of 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile?
The InChIKey is MGQAPUGDIVRMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N5/c8-7(9,10)1-2-13-6-4(3-11)5(12)14-15-6/h1-2H2,(H4,12,13,14,15).
What are the key properties of 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile?
5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile has a molecular weight of 219.17 g/mol, XLogP of 1.23, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3-(3,3,3-trifluoropropylamino)-1H-pyrazole-4-carbonitrile is sourced from PubChem (CID 102795608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).