C7H11N5 — CID 102795991
5-amino-1-ethyl-3-(methylamino)pyrazole-4-carbonitrile (PubChem CID 102795991) has the molecular formula C7H11N5 and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-amino-1-ethyl-3-(methylamino)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-ethyl-3-(methylamino)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795991 |
| Molecular Formula | C7H11N5 |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 5-amino-1-ethyl-3-(methylamino)pyrazole-4-carbonitrile |
| SMILES | CCn1nc(NC)c(C#N)c1N |
| InChI | InChI=1S/C7H11N5/c1-3-12-6(9)5(4-8)7(10-2)11-12/h3,9H2,1-2H3,(H,10,11) |
| InChIKey | ZJBOMPDEGRGTOG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |