C13H16N6O2 — CID 102797942
(3S)-3-methyl-1-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]piperazine (PubChem CID 102797942) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is (3S)-3-methyl-1-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]piperazine.
| Compound Name | (3S)-3-methyl-1-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]piperazine |
|---|---|
| PubChem CID | 102797942 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (3S)-3-methyl-1-[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]piperazine |
| SMILES | C[C@H]1CN(c2n[nH]c(-c3ccccc3[N+](=O)[O-])n2)CCN1 |
| InChI | InChI=1S/C13H16N6O2/c1-9-8-18(7-6-14-9)13-15-12(16-17-13)10-4-2-3-5-11(10)19(20)21/h2-5,9,14H,6-8H2,1H3,(H,15,16,17)/t9-/m0/s1 |
| InChIKey | ZHNMRRZQPBFFDP-VIFPVBQESA-N |
| XLogP | 1.18 |
| TPSA | 99.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|