About 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine
1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine (PubChem CID 102799267) has the molecular formula C9H17N5
and a molecular weight of 195.27 g/mol. Its IUPAC name is 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine |
| PubChem CID | 102799267 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine |
| SMILES | CC(N)C1CCN(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C9H17N5/c1-7(10)8-2-4-14(5-3-8)9-11-6-12-13-9/h6-8H,2-5,10H2,1H3,(H,11,12,13) |
| InChIKey | AMVVOSGTTQJNDI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine?
The IUPAC name of 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine (CID 102799267) is 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine.
What is the SMILES notation for 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine?
The canonical SMILES for 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine is CC(N)C1CCN(c2ncn[nH]2)CC1.
What is the InChIKey of 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine?
The InChIKey is AMVVOSGTTQJNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N5/c1-7(10)8-2-4-14(5-3-8)9-11-6-12-13-9/h6-8H,2-5,10H2,1H3,(H,11,12,13).
What are the key properties of 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine?
1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine has a molecular weight of 195.27 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(1H-1,2,4-triazol-5-yl)piperidin-4-yl]ethanamine is sourced from PubChem (CID 102799267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).