C10H12ClN3O — CID 102802514
2-(2-chloroethyl)-5-(1,3-dimethylpyrazol-4-yl)-1,3-oxazole (PubChem CID 102802514) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(1,3-dimethylpyrazol-4-yl)-1,3-oxazole.
| Compound Name | 2-(2-chloroethyl)-5-(1,3-dimethylpyrazol-4-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 102802514 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(2-chloroethyl)-5-(1,3-dimethylpyrazol-4-yl)-1,3-oxazole |
| SMILES | Cc1nn(C)cc1-c1cnc(CCCl)o1 |
| InChI | InChI=1S/C10H12ClN3O/c1-7-8(6-14(2)13-7)9-5-12-10(15-9)3-4-11/h5-6H,3-4H2,1-2H3 |
| InChIKey | XQIUSSCXGBBWBH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|