C16H18N4O — CID 102802810
1-(1,3-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanone (PubChem CID 102802810) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanone.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanone |
|---|---|
| PubChem CID | 102802810 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-2-(1-ethylindazol-3-yl)ethanone |
| SMILES | CCn1nc(CC(=O)c2cn(C)nc2C)c2ccccc21 |
| InChI | InChI=1S/C16H18N4O/c1-4-20-15-8-6-5-7-12(15)14(18-20)9-16(21)13-10-19(3)17-11(13)2/h5-8,10H,4,9H2,1-3H3 |
| InChIKey | JLSHBQVGAGONFB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |