C13H14N6O — CID 102803191
5-amino-N-(1,3-dimethylpyrazol-4-yl)-1H-indazole-3-carboxamide (PubChem CID 102803191) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 5-amino-N-(1,3-dimethylpyrazol-4-yl)-1H-indazole-3-carboxamide.
| Compound Name | 5-amino-N-(1,3-dimethylpyrazol-4-yl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 102803191 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-amino-N-(1,3-dimethylpyrazol-4-yl)-1H-indazole-3-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)c1n[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C13H14N6O/c1-7-11(6-19(2)18-7)15-13(20)12-9-5-8(14)3-4-10(9)16-17-12/h3-6H,14H2,1-2H3,(H,15,20)(H,16,17) |
| InChIKey | FYZNLCTWCIRYBH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|