C12H16N4O3S — CID 102803440
2-amino-N-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzenesulfonamide (PubChem CID 102803440) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 2-amino-N-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzenesulfonamide.
| Compound Name | 2-amino-N-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 102803440 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-amino-N-(1,3-dimethylpyrazol-4-yl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cn(C)nc2C)c(N)c1 |
| InChI | InChI=1S/C12H16N4O3S/c1-8-11(7-16(2)14-8)15-20(17,18)12-5-4-9(19-3)6-10(12)13/h4-7,15H,13H2,1-3H3 |
| InChIKey | OYVBHZDOFOCQSI-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|