About 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine
2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine (PubChem CID 102803615) has the molecular formula C11H15N5
and a molecular weight of 217.28 g/mol. Its IUPAC name is 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine.
Molecular Properties
| Compound Name | 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine |
| PubChem CID | 102803615 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine |
| SMILES | Cc1cnc(Nc2cn(C)nc2C)c(N)c1 |
| InChI | InChI=1S/C11H15N5/c1-7-4-9(12)11(13-5-7)14-10-6-16(3)15-8(10)2/h4-6H,12H2,1-3H3,(H,13,14) |
| InChIKey | AWWWERNYCYTFFA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine?
The IUPAC name of 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine (CID 102803615) is 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine.
What is the SMILES notation for 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine?
The canonical SMILES for 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine is Cc1cnc(Nc2cn(C)nc2C)c(N)c1.
What is the InChIKey of 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine?
The InChIKey is AWWWERNYCYTFFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5/c1-7-4-9(12)11(13-5-7)14-10-6-16(3)15-8(10)2/h4-6H,12H2,1-3H3,(H,13,14).
What are the key properties of 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine?
2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine has a molecular weight of 217.28 g/mol, XLogP of 1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1,3-dimethylpyrazol-4-yl)-5-methylpyridine-2,3-diamine is sourced from PubChem (CID 102803615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).