C32H33N3O5 — CID 10280418
(E)-3-[4-[[2-[[3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 10280418) has the molecular formula C32H33N3O5 and a molecular weight of 539.63 g/mol. Its IUPAC name is (E)-3-[4-[[2-[[3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[[3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10280418 |
| Molecular Formula | C32H33N3O5 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (E)-3-[4-[[2-[[3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(NC(=O)c1ccc2c(C3CCCCC3)c(-c3ccoc3)[nH]c2c1)C(=O)Nc1ccc(/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C32H33N3O5/c1-32(2,31(39)33-24-12-8-20(9-13-24)10-15-27(36)37)35-30(38)22-11-14-25-26(18-22)34-29(23-16-17-40-19-23)28(25)21-6-4-3-5-7-21/h8-19,21,34H,3-7H2,1-2H3,(H,33,39)(H,35,38)(H,36,37)/b15-10+ |
| InChIKey | SEJVGBWROZKVDP-XNTDXEJSSA-N |
| XLogP | 6.72 |
| TPSA | 124.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|