C14H17ClN4O — CID 102804809
2-chloro-N-(1,3-dimethylpyrazol-4-yl)-6-propan-2-ylpyridine-4-carboxamide (PubChem CID 102804809) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-6-propan-2-ylpyridine-4-carboxamide.
| Compound Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-6-propan-2-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 102804809 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-chloro-N-(1,3-dimethylpyrazol-4-yl)-6-propan-2-ylpyridine-4-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)c1cc(Cl)nc(C(C)C)c1 |
| InChI | InChI=1S/C14H17ClN4O/c1-8(2)11-5-10(6-13(15)16-11)14(20)17-12-7-19(4)18-9(12)3/h5-8H,1-4H3,(H,17,20) |
| InChIKey | SEDZUNKXNRMKKS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|