C14H16N4S — CID 102805130
[1-benzothiophen-7-yl-(1,3-dimethylpyrazol-4-yl)methyl]hydrazine (PubChem CID 102805130) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is [1-benzothiophen-7-yl-(1,3-dimethylpyrazol-4-yl)methyl]hydrazine.
| Compound Name | [1-benzothiophen-7-yl-(1,3-dimethylpyrazol-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 102805130 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | [1-benzothiophen-7-yl-(1,3-dimethylpyrazol-4-yl)methyl]hydrazine |
| SMILES | Cc1nn(C)cc1C(NN)c1cccc2ccsc12 |
| InChI | InChI=1S/C14H16N4S/c1-9-12(8-18(2)17-9)13(16-15)11-5-3-4-10-6-7-19-14(10)11/h3-8,13,16H,15H2,1-2H3 |
| InChIKey | CSKXCHXOJLTHOZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|