C14H16N4 — CID 102805420
3-[(1,3-dimethylpyrazol-4-yl)amino]-2-phenylpropanenitrile (PubChem CID 102805420) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[(1,3-dimethylpyrazol-4-yl)amino]-2-phenylpropanenitrile.
| Compound Name | 3-[(1,3-dimethylpyrazol-4-yl)amino]-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 102805420 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[(1,3-dimethylpyrazol-4-yl)amino]-2-phenylpropanenitrile |
| SMILES | Cc1nn(C)cc1NCC(C#N)c1ccccc1 |
| InChI | InChI=1S/C14H16N4/c1-11-14(10-18(2)17-11)16-9-13(8-15)12-6-4-3-5-7-12/h3-7,10,13,16H,9H2,1-2H3 |
| InChIKey | VCDQWNJEECCBIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |