C11H18N4O — CID 102805576
(3R)-N-(1,3-dimethylpyrazol-4-yl)piperidine-3-carboxamide (PubChem CID 102805576) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is (3R)-N-(1,3-dimethylpyrazol-4-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-dimethylpyrazol-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 102805576 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3R)-N-(1,3-dimethylpyrazol-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1nn(C)cc1NC(=O)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C11H18N4O/c1-8-10(7-15(2)14-8)13-11(16)9-4-3-5-12-6-9/h7,9,12H,3-6H2,1-2H3,(H,13,16)/t9-/m1/s1 |
| InChIKey | RJDSZJJLSFQWQJ-SECBINFHSA-N |
| XLogP | 0.67 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |