About (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid
(3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid (PubChem CID 102806615) has the molecular formula C14H24N4O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid.
Molecular Properties
| Compound Name | (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid |
| PubChem CID | 102806615 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid |
| SMILES | Cc1nn(C)cc1NC(=O)NC[C@H](CC(=O)O)CC(C)C |
| InChI | InChI=1S/C14H24N4O3/c1-9(2)5-11(6-13(19)20)7-15-14(21)16-12-8-18(4)17-10(12)3/h8-9,11H,5-7H2,1-4H3,(H,19,20)(H2,15,16,21)/t11-/m0/s1 |
| InChIKey | UXPNKWYDJVDZKT-NSHDSACASA-N |
| XLogP | 1.99 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid?
The IUPAC name of (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid (CID 102806615) is (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid.
What is the SMILES notation for (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid?
The canonical SMILES for (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid is Cc1nn(C)cc1NC(=O)NC[C@H](CC(=O)O)CC(C)C.
What is the InChIKey of (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid?
The InChIKey is UXPNKWYDJVDZKT-NSHDSACASA-N. The full InChI is InChI=1S/C14H24N4O3/c1-9(2)5-11(6-13(19)20)7-15-14(21)16-12-8-18(4)17-10(12)3/h8-9,11H,5-7H2,1-4H3,(H,19,20)(H2,15,16,21)/t11-/m0/s1.
What are the key properties of (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid?
(3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid has a molecular weight of 296.37 g/mol, XLogP of 1.99, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[[(1,3-dimethylpyrazol-4-yl)carbamoylamino]methyl]-5-methylhexanoic acid is sourced from PubChem (CID 102806615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).