C12H12ClN7 — CID 102807097
4-chloro-3-[1-(1,3-dimethylpyrazol-4-yl)tetrazol-5-yl]aniline (PubChem CID 102807097) has the molecular formula C12H12ClN7 and a molecular weight of 289.73 g/mol. Its IUPAC name is 4-chloro-3-[1-(1,3-dimethylpyrazol-4-yl)tetrazol-5-yl]aniline.
| Compound Name | 4-chloro-3-[1-(1,3-dimethylpyrazol-4-yl)tetrazol-5-yl]aniline |
|---|---|
| PubChem CID | 102807097 |
| Molecular Formula | C12H12ClN7 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-chloro-3-[1-(1,3-dimethylpyrazol-4-yl)tetrazol-5-yl]aniline |
| SMILES | Cc1nn(C)cc1-n1nnnc1-c1cc(N)ccc1Cl |
| InChI | InChI=1S/C12H12ClN7/c1-7-11(6-19(2)16-7)20-12(15-17-18-20)9-5-8(14)3-4-10(9)13/h3-6H,14H2,1-2H3 |
| InChIKey | BLLYZFJPYJORIW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|