C11H20N4 — CID 102807589
1-(1,3-dimethylpyrazol-4-yl)-3-ethylpiperazine (PubChem CID 102807589) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-ethylpiperazine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-ethylpiperazine |
|---|---|
| PubChem CID | 102807589 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-ethylpiperazine |
| SMILES | CCC1CN(c2cn(C)nc2C)CCN1 |
| InChI | InChI=1S/C11H20N4/c1-4-10-7-15(6-5-12-10)11-8-14(3)13-9(11)2/h8,10,12H,4-7H2,1-3H3 |
| InChIKey | IOUPZYUKNLHEQK-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |