C11H13ClN4 — CID 102808181
6-chloro-N-[(1-ethylpyrazol-4-yl)methyl]pyridin-2-amine (PubChem CID 102808181) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 6-chloro-N-[(1-ethylpyrazol-4-yl)methyl]pyridin-2-amine.
| Compound Name | 6-chloro-N-[(1-ethylpyrazol-4-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102808181 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 6-chloro-N-[(1-ethylpyrazol-4-yl)methyl]pyridin-2-amine |
| SMILES | CCn1cc(CNc2cccc(Cl)n2)cn1 |
| InChI | InChI=1S/C11H13ClN4/c1-2-16-8-9(7-14-16)6-13-11-5-3-4-10(12)15-11/h3-5,7-8H,2,6H2,1H3,(H,13,15) |
| InChIKey | SEOMIRJYIJASNC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|