C13H21N5O2 — CID 102808231
methyl 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-5-amino-1-methylpyrazole-4-carboxylate (PubChem CID 102808231) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-5-amino-1-methylpyrazole-4-carboxylate.
| Compound Name | methyl 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-5-amino-1-methylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102808231 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | methyl 3-(2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-1-yl)-5-amino-1-methylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(N2CCCC3CNCC32)nn(C)c1N |
| InChI | InChI=1S/C13H21N5O2/c1-17-11(14)10(13(19)20-2)12(16-17)18-5-3-4-8-6-15-7-9(8)18/h8-9,15H,3-7,14H2,1-2H3 |
| InChIKey | QUALYEMXGNEBBH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |