C16H23NO2 — CID 102809381
2-(3-hydroxyphenyl)-N-(4-methylcycloheptyl)acetamide (PubChem CID 102809381) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-N-(4-methylcycloheptyl)acetamide.
| Compound Name | 2-(3-hydroxyphenyl)-N-(4-methylcycloheptyl)acetamide |
|---|---|
| PubChem CID | 102809381 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(3-hydroxyphenyl)-N-(4-methylcycloheptyl)acetamide |
| SMILES | CC1CCCC(NC(=O)Cc2cccc(O)c2)CC1 |
| InChI | InChI=1S/C16H23NO2/c1-12-4-2-6-14(9-8-12)17-16(19)11-13-5-3-7-15(18)10-13/h3,5,7,10,12,14,18H,2,4,6,8-9,11H2,1H3,(H,17,19) |
| InChIKey | RYBAOVAMRHEAES-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |