C36H58O4 — CID 10280982
[(3S,7S,10R,13S)-7-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (Z)-heptadec-9-enoate (PubChem CID 10280982) has the molecular formula C36H58O4 and a molecular weight of 554.86 g/mol. Its IUPAC name is [(3S,7S,10R,13S)-7-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (Z)-heptadec-9-enoate.
| Compound Name | [(3S,7S,10R,13S)-7-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (Z)-heptadec-9-enoate |
|---|---|
| PubChem CID | 10280982 |
| Molecular Formula | C36H58O4 |
| Molecular Weight | 554.86 g/mol |
| Exact Mass | 554.43 |
| IUPAC Name | [(3S,7S,10R,13S)-7-hydroxy-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] (Z)-heptadec-9-enoate |
| SMILES | CCCCCCC/C=C\CCCCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC(O)C3C2CC[C@]2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C36H58O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-33(39)40-28-21-23-35(2)27(25-28)26-31(37)34-29-19-20-32(38)36(29,3)24-22-30(34)35/h10-11,26,28-31,34,37H,4-9,12-25H2,1-3H3/b11-10-/t28-,29?,30?,31?,34?,35-,36-/m0/s1 |
| InChIKey | SHJCQZOIQXJRDC-JJQCOERLSA-N |
| XLogP | 9.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.86 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|