C10H12O2 — CID 10281
2-methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione (PubChem CID 10281) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10281 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-methyl-5-propan-2-ylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=CC(=O)C(C(C)C)=CC1=O |
| InChI | InChI=1S/C10H12O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4-6H,1-3H3 |
| InChIKey | KEQHJBNSCLWCAE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|