C9H13N5S — CID 102810804
3-(3-ethyl-1-methylpyrazol-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 102810804) has the molecular formula C9H13N5S and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-(3-ethyl-1-methylpyrazol-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(3-ethyl-1-methylpyrazol-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102810804 |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-(3-ethyl-1-methylpyrazol-4-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1nn(C)cc1-c1n[nH]c(=S)n1C |
| InChI | InChI=1S/C9H13N5S/c1-4-7-6(5-13(2)12-7)8-10-11-9(15)14(8)3/h5H,4H2,1-3H3,(H,11,15) |
| InChIKey | GKAHFCMZJDPZDI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|