C8H9IN4O — CID 102811182
5-(3-ethyl-1-methylpyrazol-4-yl)-3-iodo-1,2,4-oxadiazole (PubChem CID 102811182) has the molecular formula C8H9IN4O and a molecular weight of 304.09 g/mol. Its IUPAC name is 5-(3-ethyl-1-methylpyrazol-4-yl)-3-iodo-1,2,4-oxadiazole.
| Compound Name | 5-(3-ethyl-1-methylpyrazol-4-yl)-3-iodo-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102811182 |
| Molecular Formula | C8H9IN4O |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.98 |
| IUPAC Name | 5-(3-ethyl-1-methylpyrazol-4-yl)-3-iodo-1,2,4-oxadiazole |
| SMILES | CCc1nn(C)cc1-c1nc(I)no1 |
| InChI | InChI=1S/C8H9IN4O/c1-3-6-5(4-13(2)11-6)7-10-8(9)12-14-7/h4H,3H2,1-2H3 |
| InChIKey | LJRKEWLPGZMISX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|