C12H18ClN3O2 — CID 102811387
[3-(chloromethyl)morpholin-4-yl]-(3-ethyl-1-methylpyrazol-4-yl)methanone (PubChem CID 102811387) has the molecular formula C12H18ClN3O2 and a molecular weight of 271.75 g/mol. Its IUPAC name is [3-(chloromethyl)morpholin-4-yl]-(3-ethyl-1-methylpyrazol-4-yl)methanone.
| Compound Name | [3-(chloromethyl)morpholin-4-yl]-(3-ethyl-1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 102811387 |
| Molecular Formula | C12H18ClN3O2 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [3-(chloromethyl)morpholin-4-yl]-(3-ethyl-1-methylpyrazol-4-yl)methanone |
| SMILES | CCc1nn(C)cc1C(=O)N1CCOCC1CCl |
| InChI | InChI=1S/C12H18ClN3O2/c1-3-11-10(7-15(2)14-11)12(17)16-4-5-18-8-9(16)6-13/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | SSDCMWICHKKMSV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|