C11H17N5 — CID 102812396
(3-ethyl-1-methylpyrazol-4-yl)-(1-methylimidazol-2-yl)methanamine (PubChem CID 102812396) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is (3-ethyl-1-methylpyrazol-4-yl)-(1-methylimidazol-2-yl)methanamine.
| Compound Name | (3-ethyl-1-methylpyrazol-4-yl)-(1-methylimidazol-2-yl)methanamine |
|---|---|
| PubChem CID | 102812396 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (3-ethyl-1-methylpyrazol-4-yl)-(1-methylimidazol-2-yl)methanamine |
| SMILES | CCc1nn(C)cc1C(N)c1nccn1C |
| InChI | InChI=1S/C11H17N5/c1-4-9-8(7-16(3)14-9)10(12)11-13-5-6-15(11)2/h5-7,10H,4,12H2,1-3H3 |
| InChIKey | WYSHNYWMAIOXSM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |