C15H23N3S — CID 102812405
N-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)-3-thiophen-2-ylpropan-1-amine (PubChem CID 102812405) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is N-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)-3-thiophen-2-ylpropan-1-amine.
| Compound Name | N-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)-3-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 102812405 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | N-ethyl-1-(3-ethyl-1-methylpyrazol-4-yl)-3-thiophen-2-ylpropan-1-amine |
| SMILES | CCNC(CCc1cccs1)c1cn(C)nc1CC |
| InChI | InChI=1S/C15H23N3S/c1-4-14-13(11-18(3)17-14)15(16-5-2)9-8-12-7-6-10-19-12/h6-7,10-11,15-16H,4-5,8-9H2,1-3H3 |
| InChIKey | MCOZUOMFYSFZKN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |