C11H15FN4O2 — CID 102813911
2-[3-(aminomethyl)-N-(2-amino-2-oxoethyl)-5-fluoroanilino]acetamide (PubChem CID 102813911) has the molecular formula C11H15FN4O2 and a molecular weight of 254.26 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-N-(2-amino-2-oxoethyl)-5-fluoroanilino]acetamide.
| Compound Name | 2-[3-(aminomethyl)-N-(2-amino-2-oxoethyl)-5-fluoroanilino]acetamide |
|---|---|
| PubChem CID | 102813911 |
| Molecular Formula | C11H15FN4O2 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-[3-(aminomethyl)-N-(2-amino-2-oxoethyl)-5-fluoroanilino]acetamide |
| SMILES | NCc1cc(F)cc(N(CC(N)=O)CC(N)=O)c1 |
| InChI | InChI=1S/C11H15FN4O2/c12-8-1-7(4-13)2-9(3-8)16(5-10(14)17)6-11(15)18/h1-3H,4-6,13H2,(H2,14,17)(H2,15,18) |
| InChIKey | VQCJREVCRWKNNC-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |